C19H26N2O3 — CID 21174508
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 21174508) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 21174508 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)C[C@@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-21(2)17-7-5-16(6-8-17)20-18(22)12-24-19(23)11-15-10-13-3-4-14(15)9-13/h5-8,13-15H,3-4,9-12H2,1-2H3,(H,20,22)/t13-,14-,15+/m1/s1 |
| InChIKey | MSNLQUULAHCMNF-KFWWJZLASA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|