C19H27NO2 — CID 21175592
2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide (PubChem CID 21175592) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide.
| Compound Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 21175592 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCNC(=O)C[C@H]2C[C@@H]3CC[C@@H]2C3)c(C)c1 |
| InChI | InChI=1S/C19H27NO2/c1-13-3-6-18(14(2)9-13)22-8-7-20-19(21)12-17-11-15-4-5-16(17)10-15/h3,6,9,15-17H,4-5,7-8,10-12H2,1-2H3,(H,20,21)/t15-,16-,17-/m1/s1 |
| InChIKey | UGDXHTSNJWTRLT-BRWVUGGUSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|