C23H22N2O3 — CID 21176111
2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,N-diphenylacetamide (PubChem CID 21176111) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,N-diphenylacetamide.
| Compound Name | 2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 21176111 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,N-diphenylacetamide |
| SMILES | O=C1[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C(=O)N1CC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O3/c26-19(25(17-7-3-1-4-8-17)18-9-5-2-6-10-18)14-24-22(27)20-15-11-12-16(13-15)21(20)23(24)28/h1-10,15-16,20-21H,11-14H2/t15-,16-,20-,21+/m0/s1 |
| InChIKey | DBHNLPBNMCBOCW-SNHGZMDHSA-N |
| XLogP | 3.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|