C22H21N3O5S — CID 21176519
6-methoxy-N-[2-(4-methoxyanilino)-1-methyl-3H-1,3-thiazol-4-yl]-2-oxochromene-3-carboxamide (PubChem CID 21176519) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 6-methoxy-N-[2-(4-methoxyanilino)-1-methyl-3H-1,3-thiazol-4-yl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-methoxy-N-[2-(4-methoxyanilino)-1-methyl-3H-1,3-thiazol-4-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 21176519 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 6-methoxy-N-[2-(4-methoxyanilino)-1-methyl-3H-1,3-thiazol-4-yl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(NC2=S(C)C=C(NC(=O)c3cc4cc(OC)ccc4oc3=O)N2)cc1 |
| InChI | InChI=1S/C22H21N3O5S/c1-28-15-6-4-14(5-7-15)23-22-25-19(12-31(22)3)24-20(26)17-11-13-10-16(29-2)8-9-18(13)30-21(17)27/h4-12,23,25H,1-3H3,(H,24,26) |
| InChIKey | NGASXLDUTMDVCF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|