C20H22BrFN2O — CID 21176775
2-(4-fluorophenyl)-1-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide (PubChem CID 21176775) has the molecular formula C20H22BrFN2O and a molecular weight of 405.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide.
| Compound Name | 2-(4-fluorophenyl)-1-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 21176775 |
| Molecular Formula | C20H22BrFN2O |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(4-fluorophenyl)-1-phenyl-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide |
| SMILES | OC1(c2ccc(F)cc2)C[N+]2=C(CCCCC2)N1c1ccccc1.[Br-] |
| InChI | InChI=1S/C20H22FN2O.BrH/c21-17-12-10-16(11-13-17)20(24)15-22-14-6-2-5-9-19(22)23(20)18-7-3-1-4-8-18;/h1,3-4,7-8,10-13,24H,2,5-6,9,14-15H2;1H/q+1;/p-1 |
| InChIKey | RDDAGQVGNUUQRM-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|