C27H29N2O+ — CID 21176782
1-(4-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium (PubChem CID 21176782) has the molecular formula C27H29N2O+ and a molecular weight of 397.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium.
| Compound Name | 1-(4-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium |
|---|---|
| PubChem CID | 21176782 |
| Molecular Formula | C27H29N2O+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-4-ium |
| SMILES | COc1ccc(N2C3=[N+](CCCCC3)CC2c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H29N2O/c1-30-25-17-15-24(16-18-25)29-26(20-28-19-7-3-6-10-27(28)29)23-13-11-22(12-14-23)21-8-4-2-5-9-21/h2,4-5,8-9,11-18,26H,3,6-7,10,19-20H2,1H3/q+1 |
| InChIKey | IFJTWVQRTACHLW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|