C23H20N4O2S — CID 21177802
2-[2-(2-anilino-2-oxoethyl)sulfanylbenzimidazol-1-yl]-N-phenylacetamide (PubChem CID 21177802) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[2-(2-anilino-2-oxoethyl)sulfanylbenzimidazol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[2-(2-anilino-2-oxoethyl)sulfanylbenzimidazol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 21177802 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[2-(2-anilino-2-oxoethyl)sulfanylbenzimidazol-1-yl]-N-phenylacetamide |
| SMILES | O=C(CSc1nc2ccccc2n1CC(=O)Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C23H20N4O2S/c28-21(24-17-9-3-1-4-10-17)15-27-20-14-8-7-13-19(20)26-23(27)30-16-22(29)25-18-11-5-2-6-12-18/h1-14H,15-16H2,(H,24,28)(H,25,29) |
| InChIKey | NKSVADJBDVSUQB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |