C25H32N2O — CID 21177863
(1E,4E)-1,5-bis[4-(diethylamino)phenyl]penta-1,4-dien-3-one (PubChem CID 21177863) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[4-(diethylamino)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[4-(diethylamino)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 21177863 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (1E,4E)-1,5-bis[4-(diethylamino)phenyl]penta-1,4-dien-3-one |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)/C=C/c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O/c1-5-26(6-2)23-15-9-21(10-16-23)13-19-25(28)20-14-22-11-17-24(18-12-22)27(7-3)8-4/h9-20H,5-8H2,1-4H3/b19-13+,20-14+ |
| InChIKey | ZNNRTWIXUUGIFI-IWGRKNQJSA-N |
| XLogP | 5.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|