C25H21N4NaO5S2 — CID 21178091
sodium 4-[[5-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl]-1,3,4-thiadiazol-2-yl]amino]benzenesulfonate (PubChem CID 21178091) has the molecular formula C25H21N4NaO5S2 and a molecular weight of 544.59 g/mol. Its IUPAC name is sodium 4-[[5-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl]-1,3,4-thiadiazol-2-yl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[5-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl]-1,3,4-thiadiazol-2-yl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 21178091 |
| Molecular Formula | C25H21N4NaO5S2 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | sodium 4-[[5-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl]-1,3,4-thiadiazol-2-yl]amino]benzenesulfonate |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCCCCc1nnc(Nc2ccc(S(=O)(=O)[O-])cc2)s1.[Na+] |
| InChI | InChI=1S/C25H22N4O5S2.Na/c30-23-19-8-4-6-16-7-5-9-20(22(16)19)24(31)29(23)15-3-1-2-10-21-27-28-25(35-21)26-17-11-13-18(14-12-17)36(32,33)34;/h4-9,11-14H,1-3,10,15H2,(H,26,28)(H,32,33,34);/q;+1/p-1 |
| InChIKey | OMLKOIDGTSCDID-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|