C22H17NO4 — CID 21178174
3-(2,5-dihydroxybenzoyl)-2-(4-methylphenyl)-3H-isoindol-1-one (PubChem CID 21178174) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-(2,5-dihydroxybenzoyl)-2-(4-methylphenyl)-3H-isoindol-1-one.
| Compound Name | 3-(2,5-dihydroxybenzoyl)-2-(4-methylphenyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 21178174 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-(2,5-dihydroxybenzoyl)-2-(4-methylphenyl)-3H-isoindol-1-one |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3C2C(=O)c2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C22H17NO4/c1-13-6-8-14(9-7-13)23-20(16-4-2-3-5-17(16)22(23)27)21(26)18-12-15(24)10-11-19(18)25/h2-12,20,24-25H,1H3 |
| InChIKey | LRUCNDJIDJRIIB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|