C13H14ClN2O3S- — CID 21178192
(5Z)-3-(2-aminoethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione chloride (PubChem CID 21178192) has the molecular formula C13H14ClN2O3S- and a molecular weight of 313.79 g/mol. Its IUPAC name is (5Z)-3-(2-aminoethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione chloride.
| Compound Name | (5Z)-3-(2-aminoethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione chloride |
|---|---|
| PubChem CID | 21178192 |
| Molecular Formula | C13H14ClN2O3S- |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (5Z)-3-(2-aminoethyl)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione chloride |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCN)C2=O)cc1.[Cl-] |
| InChI | InChI=1S/C13H14N2O3S.ClH/c1-18-10-4-2-9(3-5-10)8-11-12(16)15(7-6-14)13(17)19-11;/h2-5,8H,6-7,14H2,1H3;1H/p-1/b11-8-; |
| InChIKey | LEDGHOKSFJGTLU-MKFZHGHUSA-M |
| XLogP | -1.31 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|