C16H20N4O3S — CID 21178212
ethyl (3E)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)hydrazinylidene]butanoate (PubChem CID 21178212) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is ethyl (3E)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)hydrazinylidene]butanoate.
| Compound Name | ethyl (3E)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 21178212 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | ethyl (3E)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C/C(C)=N/Nc1nc2sc3c(c2c(=O)[nH]1)CCCC3 |
| InChI | InChI=1S/C16H20N4O3S/c1-3-23-12(21)8-9(2)19-20-16-17-14(22)13-10-6-4-5-7-11(10)24-15(13)18-16/h3-8H2,1-2H3,(H2,17,18,20,22)/b19-9+ |
| InChIKey | XHUDTQXBMCPYKM-DJKKODMXSA-N |
| XLogP | 2.60 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|