C18H15Br2N2S+ — CID 21178831
1,2-bis(4-bromophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium (PubChem CID 21178831) has the molecular formula C18H15Br2N2S+ and a molecular weight of 451.21 g/mol. Its IUPAC name is 1,2-bis(4-bromophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium.
| Compound Name | 1,2-bis(4-bromophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium |
|---|---|
| PubChem CID | 21178831 |
| Molecular Formula | C18H15Br2N2S+ |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 448.93 |
| IUPAC Name | 1,2-bis(4-bromophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium |
| SMILES | Brc1ccc(-c2c[n+]3c(n2-c2ccc(Br)cc2)SCCC3)cc1 |
| InChI | InChI=1S/C18H15Br2N2S/c19-14-4-2-13(3-5-14)17-12-21-10-1-11-23-18(21)22(17)16-8-6-15(20)7-9-16/h2-9,12H,1,10-11H2/q+1 |
| InChIKey | QEGCUWGLVOPWLA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|