C10H7Cl3F3NO2P+ — CID 21179217
oxo-phenyl-[2,2,2-trichloro-1-[(2,2,2-trifluoroacetyl)amino]ethyl]phosphanium (PubChem CID 21179217) has the molecular formula C10H7Cl3F3NO2P+ and a molecular weight of 367.50 g/mol. Its IUPAC name is oxo-phenyl-[2,2,2-trichloro-1-[(2,2,2-trifluoroacetyl)amino]ethyl]phosphanium.
| Compound Name | oxo-phenyl-[2,2,2-trichloro-1-[(2,2,2-trifluoroacetyl)amino]ethyl]phosphanium |
|---|---|
| PubChem CID | 21179217 |
| Molecular Formula | C10H7Cl3F3NO2P+ |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | oxo-phenyl-[2,2,2-trichloro-1-[(2,2,2-trifluoroacetyl)amino]ethyl]phosphanium |
| SMILES | O=C(NC([P+](=O)c1ccccc1)C(Cl)(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C10H6Cl3F3NO2P/c11-9(12,13)8(17-7(18)10(14,15)16)20(19)6-4-2-1-3-5-6/h1-5,8H/p+1 |
| InChIKey | OOOACAHGFNETGX-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|