About [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate
[4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate (PubChem CID 21179689) has the molecular formula C18H18FNO4S
and a molecular weight of 363.41 g/mol. Its IUPAC name is [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate |
| PubChem CID | 21179689 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate |
| SMILES | Cc1ccc(NC2CS(=O)(=O)CC2OC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C18H18FNO4S/c1-12-6-8-13(9-7-12)20-16-10-25(22,23)11-17(16)24-18(21)14-4-2-3-5-15(14)19/h2-9,16-17,20H,10-11H2,1H3 |
| InChIKey | FBWYKVFWLJHKBR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate?
The IUPAC name of [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate (CID 21179689) is [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate.
What is the SMILES notation for [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate?
The canonical SMILES for [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate is Cc1ccc(NC2CS(=O)(=O)CC2OC(=O)c2ccccc2F)cc1.
What is the InChIKey of [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate?
The InChIKey is FBWYKVFWLJHKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO4S/c1-12-6-8-13(9-7-12)20-16-10-25(22,23)11-17(16)24-18(21)14-4-2-3-5-15(14)19/h2-9,16-17,20H,10-11H2,1H3.
What are the key properties of [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate?
[4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate has a molecular weight of 363.41 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methylanilino)-1,1-dioxothiolan-3-yl] 2-fluorobenzoate is sourced from PubChem (CID 21179689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).