C24H30N2O5S — CID 2117973
(E)-N-(2-tert-butylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 2117973) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is (E)-N-(2-tert-butylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-tert-butylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2117973 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (E)-N-(2-tert-butylphenyl)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(C)(C)C)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H30N2O5S/c1-24(2,3)19-7-5-6-8-20(19)25-23(27)12-10-18-9-11-21(30-4)22(17-18)32(28,29)26-13-15-31-16-14-26/h5-12,17H,13-16H2,1-4H3,(H,25,27)/b12-10+ |
| InChIKey | KMBJRAHZCZIZAZ-ZRDIBKRKSA-N |
| XLogP | 3.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|