About N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride
N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride (PubChem CID 21179737) has the molecular formula C8H17ClNO2S-
and a molecular weight of 226.75 g/mol. Its IUPAC name is N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride |
| PubChem CID | 21179737 |
| Molecular Formula | C8H17ClNO2S- |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride |
| SMILES | CC(C)CNC1CCS(=O)(=O)C1.[Cl-] |
| InChI | InChI=1S/C8H17NO2S.ClH/c1-7(2)5-9-8-3-4-12(10,11)6-8;/h7-9H,3-6H2,1-2H3;1H/p-1 |
| InChIKey | ZDLVGFBKARGQEG-UHFFFAOYSA-M |
| XLogP | -2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride?
The IUPAC name of N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride (CID 21179737) is N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride.
What is the SMILES notation for N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride?
The canonical SMILES for N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride is CC(C)CNC1CCS(=O)(=O)C1.[Cl-].
What is the InChIKey of N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride?
The InChIKey is ZDLVGFBKARGQEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17NO2S.ClH/c1-7(2)5-9-8-3-4-12(10,11)6-8;/h7-9H,3-6H2,1-2H3;1H/p-1.
What are the key properties of N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride?
N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride has a molecular weight of 226.75 g/mol, XLogP of -2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-1,1-dioxothiolan-3-amine chloride is sourced from PubChem (CID 21179737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).