About 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide
3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 21179757) has the molecular formula C11H19NO2S
and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
Analyze 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide (CID 21179757) is 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide is CC1CCCC(C)N1C1C=CS(=O)(=O)C1.
What is the InChIKey of 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is HNELVZBEZNVYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S/c1-9-4-3-5-10(2)12(9)11-6-7-15(13,14)8-11/h6-7,9-11H,3-5,8H2,1-2H3.
What are the key properties of 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 229.34 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 21179757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).