About 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide
3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 21179759) has the molecular formula C11H19NO2S
and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| PubChem CID | 21179759 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | CCC1CCCCN1C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO2S/c1-2-10-5-3-4-7-12(10)11-6-8-15(13,14)9-11/h6,8,10-11H,2-5,7,9H2,1H3 |
| InChIKey | YHRZRLXJGPQSOH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide (CID 21179759) is 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide is CCC1CCCCN1C1C=CS(=O)(=O)C1.
What is the InChIKey of 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is YHRZRLXJGPQSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S/c1-2-10-5-3-4-7-12(10)11-6-8-15(13,14)9-11/h6,8,10-11H,2-5,7,9H2,1H3.
What are the key properties of 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 229.34 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylpiperidin-1-yl)-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 21179759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).