About 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride
4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride (PubChem CID 21179772) has the molecular formula C8H15ClNO4S-
and a molecular weight of 256.73 g/mol. Its IUPAC name is 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride.
Molecular Properties
| Compound Name | 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride |
| PubChem CID | 21179772 |
| Molecular Formula | C8H15ClNO4S- |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride |
| SMILES | O=S1(=O)CC(O)C(N2CCOCC2)C1.[Cl-] |
| InChI | InChI=1S/C8H15NO4S.ClH/c10-8-6-14(11,12)5-7(8)9-1-3-13-4-2-9;/h7-8,10H,1-6H2;1H/p-1 |
| InChIKey | RIFNJJIZKOZUBE-UHFFFAOYSA-M |
| XLogP | -4.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride?
The IUPAC name of 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride (CID 21179772) is 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride.
What is the SMILES notation for 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride?
The canonical SMILES for 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride is O=S1(=O)CC(O)C(N2CCOCC2)C1.[Cl-].
What is the InChIKey of 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride?
The InChIKey is RIFNJJIZKOZUBE-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15NO4S.ClH/c10-8-6-14(11,12)5-7(8)9-1-3-13-4-2-9;/h7-8,10H,1-6H2;1H/p-1.
What are the key properties of 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride?
4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride has a molecular weight of 256.73 g/mol, XLogP of -4.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-yl-1,1-dioxothiolan-3-ol chloride is sourced from PubChem (CID 21179772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).