About 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride
4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride (PubChem CID 21179791) has the molecular formula C9H20ClN2O3S-
and a molecular weight of 271.79 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride.
Molecular Properties
| Compound Name | 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride |
| PubChem CID | 21179791 |
| Molecular Formula | C9H20ClN2O3S- |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride |
| SMILES | CN(C)CCCNC1CS(=O)(=O)CC1O.[Cl-] |
| InChI | InChI=1S/C9H20N2O3S.ClH/c1-11(2)5-3-4-10-8-6-15(13,14)7-9(8)12;/h8-10,12H,3-7H2,1-2H3;1H/p-1 |
| InChIKey | ZCWNJPKILUGSOR-UHFFFAOYSA-M |
| XLogP | -4.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride?
The IUPAC name of 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride (CID 21179791) is 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride.
What is the SMILES notation for 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride?
The canonical SMILES for 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride is CN(C)CCCNC1CS(=O)(=O)CC1O.[Cl-].
What is the InChIKey of 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride?
The InChIKey is ZCWNJPKILUGSOR-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20N2O3S.ClH/c1-11(2)5-3-4-10-8-6-15(13,14)7-9(8)12;/h8-10,12H,3-7H2,1-2H3;1H/p-1.
What are the key properties of 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride?
4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride has a molecular weight of 271.79 g/mol, XLogP of -4.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(dimethylamino)propylamino]-1,1-dioxothiolan-3-ol chloride is sourced from PubChem (CID 21179791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).