About 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile
3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile (PubChem CID 21180499) has the molecular formula C16H9Cl2N3
and a molecular weight of 314.18 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile |
| PubChem CID | 21180499 |
| Molecular Formula | C16H9Cl2N3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cnc(-c3ccc(Cl)c(Cl)c3)[nH]2)c1 |
| InChI | InChI=1S/C16H9Cl2N3/c17-13-5-4-12(7-14(13)18)16-20-9-15(21-16)11-3-1-2-10(6-11)8-19/h1-7,9H,(H,20,21) |
| InChIKey | NYKXXNDWEPRIOC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile?
The IUPAC name of 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile (CID 21180499) is 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile.
What is the SMILES notation for 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile?
The canonical SMILES for 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile is N#Cc1cccc(-c2cnc(-c3ccc(Cl)c(Cl)c3)[nH]2)c1.
What is the InChIKey of 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile?
The InChIKey is NYKXXNDWEPRIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl2N3/c17-13-5-4-12(7-14(13)18)16-20-9-15(21-16)11-3-1-2-10(6-11)8-19/h1-7,9H,(H,20,21).
What are the key properties of 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile?
3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile has a molecular weight of 314.18 g/mol, XLogP of 4.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]benzonitrile is sourced from PubChem (CID 21180499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).