About 3-(3,4-difluorophenyl)propan-1-ol
3-(3,4-difluorophenyl)propan-1-ol (PubChem CID 21180699) has the molecular formula C9H10F2O
and a molecular weight of 172.17 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)propan-1-ol |
| PubChem CID | 21180699 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-(3,4-difluorophenyl)propan-1-ol |
| SMILES | OCCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H10F2O/c10-8-4-3-7(2-1-5-12)6-9(8)11/h3-4,6,12H,1-2,5H2 |
| InChIKey | WPGWMWLTWJAIJZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-difluorophenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)propan-1-ol?
The IUPAC name of 3-(3,4-difluorophenyl)propan-1-ol (CID 21180699) is 3-(3,4-difluorophenyl)propan-1-ol.
What is the SMILES notation for 3-(3,4-difluorophenyl)propan-1-ol?
The canonical SMILES for 3-(3,4-difluorophenyl)propan-1-ol is OCCCc1ccc(F)c(F)c1.
What is the InChIKey of 3-(3,4-difluorophenyl)propan-1-ol?
The InChIKey is WPGWMWLTWJAIJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2O/c10-8-4-3-7(2-1-5-12)6-9(8)11/h3-4,6,12H,1-2,5H2.
What are the key properties of 3-(3,4-difluorophenyl)propan-1-ol?
3-(3,4-difluorophenyl)propan-1-ol has a molecular weight of 172.17 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)propan-1-ol is sourced from PubChem (CID 21180699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).