C25H30Br2N2 — CID 21181037
5-[benzyl(methyl)amino]-2-cyclohexyl-2-(3,4-dibromophenyl)pentanenitrile (PubChem CID 21181037) has the molecular formula C25H30Br2N2 and a molecular weight of 518.34 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-2-cyclohexyl-2-(3,4-dibromophenyl)pentanenitrile.
| Compound Name | 5-[benzyl(methyl)amino]-2-cyclohexyl-2-(3,4-dibromophenyl)pentanenitrile |
|---|---|
| PubChem CID | 21181037 |
| Molecular Formula | C25H30Br2N2 |
| Molecular Weight | 518.34 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 5-[benzyl(methyl)amino]-2-cyclohexyl-2-(3,4-dibromophenyl)pentanenitrile |
| SMILES | CN(CCCC(C#N)(c1ccc(Br)c(Br)c1)C1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C25H30Br2N2/c1-29(18-20-9-4-2-5-10-20)16-8-15-25(19-28,21-11-6-3-7-12-21)22-13-14-23(26)24(27)17-22/h2,4-5,9-10,13-14,17,21H,3,6-8,11-12,15-16,18H2,1H3 |
| InChIKey | XDOQBQZIOFQJCM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.34 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |