C24H29ClN2 — CID 21181334
2-(4-chlorophenyl)-2-cyclopropyl-5-[ethyl(2-phenylethyl)amino]pentanenitrile (PubChem CID 21181334) has the molecular formula C24H29ClN2 and a molecular weight of 380.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-cyclopropyl-5-[ethyl(2-phenylethyl)amino]pentanenitrile.
| Compound Name | 2-(4-chlorophenyl)-2-cyclopropyl-5-[ethyl(2-phenylethyl)amino]pentanenitrile |
|---|---|
| PubChem CID | 21181334 |
| Molecular Formula | C24H29ClN2 |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-(4-chlorophenyl)-2-cyclopropyl-5-[ethyl(2-phenylethyl)amino]pentanenitrile |
| SMILES | CCN(CCCC(C#N)(c1ccc(Cl)cc1)C1CC1)CCc1ccccc1 |
| InChI | InChI=1S/C24H29ClN2/c1-2-27(18-15-20-7-4-3-5-8-20)17-6-16-24(19-26,21-9-10-21)22-11-13-23(25)14-12-22/h3-5,7-8,11-14,21H,2,6,9-10,15-18H2,1H3 |
| InChIKey | OSBFZVIXZDNMHI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |