C24H27F3N2 — CID 21181405
2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-[2-(trifluoromethyl)phenyl]pentanenitrile (PubChem CID 21181405) has the molecular formula C24H27F3N2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-[2-(trifluoromethyl)phenyl]pentanenitrile.
| Compound Name | 2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-[2-(trifluoromethyl)phenyl]pentanenitrile |
|---|---|
| PubChem CID | 21181405 |
| Molecular Formula | C24H27F3N2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-[2-(trifluoromethyl)phenyl]pentanenitrile |
| SMILES | CN(CCCC(C#N)(c1ccccc1C(F)(F)F)C1CC1)CCc1ccccc1 |
| InChI | InChI=1S/C24H27F3N2/c1-29(17-14-19-8-3-2-4-9-19)16-7-15-23(18-28,20-12-13-20)21-10-5-6-11-22(21)24(25,26)27/h2-6,8-11,20H,7,12-17H2,1H3 |
| InChIKey | JJDZJDJOKDUPTG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |