C28H56N2O — CID 21182097
2,2,6,6-tetraethyl-4-methyl-1-(2,2,6,6-tetraethyl-4-methylpiperidin-1-yl)oxypiperidine (PubChem CID 21182097) has the molecular formula C28H56N2O and a molecular weight of 436.77 g/mol. Its IUPAC name is 2,2,6,6-tetraethyl-4-methyl-1-(2,2,6,6-tetraethyl-4-methylpiperidin-1-yl)oxypiperidine.
| Compound Name | 2,2,6,6-tetraethyl-4-methyl-1-(2,2,6,6-tetraethyl-4-methylpiperidin-1-yl)oxypiperidine |
|---|---|
| PubChem CID | 21182097 |
| Molecular Formula | C28H56N2O |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.44 |
| IUPAC Name | 2,2,6,6-tetraethyl-4-methyl-1-(2,2,6,6-tetraethyl-4-methylpiperidin-1-yl)oxypiperidine |
| SMILES | CCC1(CC)CC(C)CC(CC)(CC)N1ON1C(CC)(CC)CC(C)CC1(CC)CC |
| InChI | InChI=1S/C28H56N2O/c1-11-25(12-2)19-23(9)20-26(13-3,14-4)29(25)31-30-27(15-5,16-6)21-24(10)22-28(30,17-7)18-8/h23-24H,11-22H2,1-10H3 |
| InChIKey | DXKIOQPJZDGJQD-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |