C20H40N2O — CID 21182099
2,2,4,6,6-pentamethyl-1-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypiperidine (PubChem CID 21182099) has the molecular formula C20H40N2O and a molecular weight of 324.55 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-1-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypiperidine.
| Compound Name | 2,2,4,6,6-pentamethyl-1-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypiperidine |
|---|---|
| PubChem CID | 21182099 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-1-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypiperidine |
| SMILES | CC1CC(C)(C)N(ON2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C20H40N2O/c1-15-11-17(3,4)21(18(5,6)12-15)23-22-19(7,8)13-16(2)14-20(22,9)10/h15-16H,11-14H2,1-10H3 |
| InChIKey | GTZIRGRXHUPURB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |