C18H15N3O3S — CID 2118300
6-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 2118300) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 6-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2118300 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 6-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccccc1Nc1nc(-c2ccc3c(c2)NC(=O)CO3)cs1 |
| InChI | InChI=1S/C18H15N3O3S/c1-23-15-5-3-2-4-12(15)20-18-21-14(10-25-18)11-6-7-16-13(8-11)19-17(22)9-24-16/h2-8,10H,9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | UROYMMCAGIAILL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |