C23H15NO5S — CID 21183513
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;1,3-thiazole (PubChem CID 21183513) has the molecular formula C23H15NO5S and a molecular weight of 417.44 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;1,3-thiazole.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;1,3-thiazole |
|---|---|
| PubChem CID | 21183513 |
| Molecular Formula | C23H15NO5S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;1,3-thiazole |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21.c1cscn1 |
| InChI | InChI=1S/C20H12O5.C3H3NS/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;1-2-5-3-4-1/h1-10,21-22H;1-3H |
| InChIKey | AKAXBIHTZWKPLS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |