About 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid
2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid (PubChem CID 21183735) has the molecular formula C20H16FN3O3
and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid |
| PubChem CID | 21183735 |
| Molecular Formula | C20H16FN3O3 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid |
| SMILES | CCn1c2ccc(F)cc2c2c(CC(=O)O)nn(-c3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C20H16FN3O3/c1-2-23-16-9-8-12(21)10-14(16)18-15(11-17(25)26)22-24(20(27)19(18)23)13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H,25,26) |
| InChIKey | SHDYVPKEQTWDQE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid?
The IUPAC name of 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid (CID 21183735) is 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid.
What is the SMILES notation for 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid?
The canonical SMILES for 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid is CCn1c2ccc(F)cc2c2c(CC(=O)O)nn(-c3ccccc3)c(=O)c21.
What is the InChIKey of 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid?
The InChIKey is SHDYVPKEQTWDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN3O3/c1-2-23-16-9-8-12(21)10-14(16)18-15(11-17(25)26)22-24(20(27)19(18)23)13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H,25,26).
What are the key properties of 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid?
2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid has a molecular weight of 365.36 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-8-fluoro-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)acetic acid is sourced from PubChem (CID 21183735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).