About ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate
ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate (PubChem CID 21184034) has the molecular formula C24H27ClN4O4
and a molecular weight of 470.96 g/mol. Its IUPAC name is ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate.
Molecular Properties
| Compound Name | ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate |
| PubChem CID | 21184034 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNc1nc(NCc2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C24H27ClN4O4/c1-2-31-22(30)6-4-3-5-11-26-24-28-19-9-8-17(25)13-18(19)23(29-24)27-14-16-7-10-20-21(12-16)33-15-32-20/h7-10,12-13H,2-6,11,14-15H2,1H3,(H2,26,27,28,29) |
| InChIKey | BVQXBNPCVKDGAP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate?
The IUPAC name of ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate (CID 21184034) is ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate.
What is the SMILES notation for ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate?
The canonical SMILES for ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate is CCOC(=O)CCCCCNc1nc(NCc2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1.
What is the InChIKey of ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate?
The InChIKey is BVQXBNPCVKDGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27ClN4O4/c1-2-31-22(30)6-4-3-5-11-26-24-28-19-9-8-17(25)13-18(19)23(29-24)27-14-16-7-10-20-21(12-16)33-15-32-20/h7-10,12-13H,2-6,11,14-15H2,1H3,(H2,26,27,28,29).
What are the key properties of ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate?
ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate has a molecular weight of 470.96 g/mol, XLogP of 5.16, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoate is sourced from PubChem (CID 21184034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).