About acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene
acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 21184216) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| PubChem CID | 21184216 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CC(=O)O.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C6H4O.C2H4O2/c1-2-4-6-5(3-1)7-6;1-2(3)4/h1-4H;1H3,(H,3,4) |
| InChIKey | WANTUMFDPFCVAA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
The IUPAC name of acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene (CID 21184216) is acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
What is the SMILES notation for acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
The canonical SMILES for acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene is CC(=O)O.c1ccc2c(c1)O2.
What is the InChIKey of acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
The InChIKey is WANTUMFDPFCVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.C2H4O2/c1-2-4-6-5(3-1)7-6;1-2(3)4/h1-4H;1H3,(H,3,4).
What are the key properties of acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene?
acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene has a molecular weight of 152.15 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene is sourced from PubChem (CID 21184216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).