About 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione
2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione (PubChem CID 21184376) has the molecular formula C16H9NO4S
and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione |
| PubChem CID | 21184376 |
| Molecular Formula | C16H9NO4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione |
| SMILES | COc1cccc2c1C(=O)c1nc(-c3ccco3)sc1C2=O |
| InChI | InChI=1S/C16H9NO4S/c1-20-9-5-2-4-8-11(9)14(19)12-15(13(8)18)22-16(17-12)10-6-3-7-21-10/h2-7H,1H3 |
| InChIKey | QMVLNNDZQQMMHT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione?
The IUPAC name of 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione (CID 21184376) is 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione.
What is the SMILES notation for 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione?
The canonical SMILES for 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione is COc1cccc2c1C(=O)c1nc(-c3ccco3)sc1C2=O.
What is the InChIKey of 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione?
The InChIKey is QMVLNNDZQQMMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO4S/c1-20-9-5-2-4-8-11(9)14(19)12-15(13(8)18)22-16(17-12)10-6-3-7-21-10/h2-7H,1H3.
What are the key properties of 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione?
2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione has a molecular weight of 311.32 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-5-methoxybenzo[f][1,3]benzothiazole-4,9-dione is sourced from PubChem (CID 21184376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).