C20H18BrN3O4 — CID 21184630
aniline;4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzoic acid (PubChem CID 21184630) has the molecular formula C20H18BrN3O4 and a molecular weight of 444.29 g/mol. Its IUPAC name is aniline;4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzoic acid.
| Compound Name | aniline;4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 21184630 |
| Molecular Formula | C20H18BrN3O4 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | aniline;4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzoic acid |
| SMILES | Nc1ccccc1.O=C(Nc1ccc(C(=O)O)cc1O)Nc1ccccc1Br |
| InChI | InChI=1S/C14H11BrN2O4.C6H7N/c15-9-3-1-2-4-10(9)16-14(21)17-11-6-5-8(13(19)20)7-12(11)18;7-6-4-2-1-3-5-6/h1-7,18H,(H,19,20)(H2,16,17,21);1-5H,7H2 |
| InChIKey | HCCOZLPEWKCHJI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|