About methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid
methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid (PubChem CID 21185186) has the molecular formula C18H18N2O5
and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid.
Molecular Properties
| Compound Name | methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid |
| PubChem CID | 21185186 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid |
| SMILES | CN(Cc1ccc(NC(=O)c2coc3c2C(=O)CCC3)cc1)C(=O)O |
| InChI | InChI=1S/C18H18N2O5/c1-20(18(23)24)9-11-5-7-12(8-6-11)19-17(22)13-10-25-15-4-2-3-14(21)16(13)15/h5-8,10H,2-4,9H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | QDQJNPXIXIKDNX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid?
The IUPAC name of methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid (CID 21185186) is methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid.
What is the SMILES notation for methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid?
The canonical SMILES for methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid is CN(Cc1ccc(NC(=O)c2coc3c2C(=O)CCC3)cc1)C(=O)O.
What is the InChIKey of methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid?
The InChIKey is QDQJNPXIXIKDNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O5/c1-20(18(23)24)9-11-5-7-12(8-6-11)19-17(22)13-10-25-15-4-2-3-14(21)16(13)15/h5-8,10H,2-4,9H2,1H3,(H,19,22)(H,23,24).
What are the key properties of methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid?
methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid has a molecular weight of 342.35 g/mol, XLogP of 3.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[[4-[(4-oxo-6,7-dihydro-5H-1-benzofuran-3-carbonyl)amino]phenyl]methyl]carbamic acid is sourced from PubChem (CID 21185186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).