About 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one
1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one (PubChem CID 21185205) has the molecular formula C9H11ClN6O
and a molecular weight of 254.68 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one.
Molecular Properties
| Compound Name | 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one |
| PubChem CID | 21185205 |
| Molecular Formula | C9H11ClN6O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one |
| SMILES | C=Cn1nnn(Cc2c(Cl)c(C)nn2C)c1=O |
| InChI | InChI=1S/C9H11ClN6O/c1-4-15-9(17)16(13-12-15)5-7-8(10)6(2)11-14(7)3/h4H,1,5H2,2-3H3 |
| InChIKey | XESXOGNGSUFVKL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one?
The IUPAC name of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one (CID 21185205) is 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one.
What is the SMILES notation for 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one?
The canonical SMILES for 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one is C=Cn1nnn(Cc2c(Cl)c(C)nn2C)c1=O.
What is the InChIKey of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one?
The InChIKey is XESXOGNGSUFVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN6O/c1-4-15-9(17)16(13-12-15)5-7-8(10)6(2)11-14(7)3/h4H,1,5H2,2-3H3.
What are the key properties of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one?
1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one has a molecular weight of 254.68 g/mol, XLogP of 0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-4-ethenyltetrazol-5-one is sourced from PubChem (CID 21185205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).