About bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate
bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate (PubChem CID 21185425) has the molecular formula C32H54N4O4
and a molecular weight of 558.81 g/mol. Its IUPAC name is bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate.
Molecular Properties
| Compound Name | bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate |
| PubChem CID | 21185425 |
| Molecular Formula | C32H54N4O4 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.41 |
| IUPAC Name | bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate |
| SMILES | CCCCC(CC)C1=[N+](C)CCN1C.CCCCC(CC)C1=[N+](C)CCN1C.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/2C12H25N2.C8H6O4/c2*1-5-7-8-11(6-2)12-13(3)9-10-14(12)4;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*11H,5-10H2,1-4H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | URYWHQNGEWOVJT-UHFFFAOYSA-L |
| XLogP | 2.79 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate?
The IUPAC name of bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate (CID 21185425) is bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate.
What is the SMILES notation for bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate?
The canonical SMILES for bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate is CCCCC(CC)C1=[N+](C)CCN1C.CCCCC(CC)C1=[N+](C)CCN1C.O=C([O-])c1ccccc1C(=O)[O-].
What is the InChIKey of bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate?
The InChIKey is URYWHQNGEWOVJT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H25N2.C8H6O4/c2*1-5-7-8-11(6-2)12-13(3)9-10-14(12)4;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*11H,5-10H2,1-4H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2.
What are the key properties of bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate?
bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate has a molecular weight of 558.81 g/mol, XLogP of 2.79, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-heptan-3-yl-1,3-dimethyl-4,5-dihydroimidazol-1-ium);phthalate is sourced from PubChem (CID 21185425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).