About 2,2-diacetylpropanediamide
2,2-diacetylpropanediamide (PubChem CID 21185468) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is 2,2-diacetylpropanediamide.
Molecular Properties
| Compound Name | 2,2-diacetylpropanediamide |
| PubChem CID | 21185468 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2,2-diacetylpropanediamide |
| SMILES | CC(=O)C(C(C)=O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C7H10N2O4/c1-3(10)7(4(2)11,5(8)12)6(9)13/h1-2H3,(H2,8,12)(H2,9,13) |
| InChIKey | JJGKIBVWLHRDII-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diacetylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diacetylpropanediamide?
The IUPAC name of 2,2-diacetylpropanediamide (CID 21185468) is 2,2-diacetylpropanediamide.
What is the SMILES notation for 2,2-diacetylpropanediamide?
The canonical SMILES for 2,2-diacetylpropanediamide is CC(=O)C(C(C)=O)(C(N)=O)C(N)=O.
What is the InChIKey of 2,2-diacetylpropanediamide?
The InChIKey is JJGKIBVWLHRDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-3(10)7(4(2)11,5(8)12)6(9)13/h1-2H3,(H2,8,12)(H2,9,13).
What are the key properties of 2,2-diacetylpropanediamide?
2,2-diacetylpropanediamide has a molecular weight of 186.17 g/mol, XLogP of -1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diacetylpropanediamide is sourced from PubChem (CID 21185468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).