C14H16N2O3S — CID 2118575
3-(3,4-dimethoxyphenyl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 2118575) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 2118575 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2nccs2)cc1OC |
| InChI | InChI=1S/C14H16N2O3S/c1-18-11-5-3-10(9-12(11)19-2)4-6-13(17)16-14-15-7-8-20-14/h3,5,7-9H,4,6H2,1-2H3,(H,15,16,17) |
| InChIKey | PTMIHNZOXOWATA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |