C23H26O — CID 21185927
3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzaldehyde (PubChem CID 21185927) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzaldehyde.
| Compound Name | 3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 21185927 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzaldehyde |
| SMILES | C=C(c1cccc(C=O)c1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H26O/c1-16(18-8-6-7-17(13-18)15-24)19-9-10-20-21(14-19)23(4,5)12-11-22(20,2)3/h6-10,13-15H,1,11-12H2,2-5H3 |
| InChIKey | FSKMUNDBTKZZLO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|