About 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide
6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide (PubChem CID 21186404) has the molecular formula C21H20N2O2
and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide.
Molecular Properties
| Compound Name | 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide |
| PubChem CID | 21186404 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(/C=C/c3ccc(C(O)CO)cc3)ccc2c1 |
| InChI | InChI=1S/C21H20N2O2/c22-21(23)19-10-9-17-11-15(5-8-18(17)12-19)2-1-14-3-6-16(7-4-14)20(25)13-24/h1-12,20,24-25H,13H2,(H3,22,23)/b2-1+ |
| InChIKey | HVELETPLHUECES-OWOJBTEDSA-N |
| XLogP | 3.32 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide?
The IUPAC name of 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide (CID 21186404) is 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide.
What is the SMILES notation for 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide?
The canonical SMILES for 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide is [H]/N=C(\N)c1ccc2cc(/C=C/c3ccc(C(O)CO)cc3)ccc2c1.
What is the InChIKey of 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide?
The InChIKey is HVELETPLHUECES-OWOJBTEDSA-N. The full InChI is InChI=1S/C21H20N2O2/c22-21(23)19-10-9-17-11-15(5-8-18(17)12-19)2-1-14-3-6-16(7-4-14)20(25)13-24/h1-12,20,24-25H,13H2,(H3,22,23)/b2-1+.
What are the key properties of 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide?
6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide has a molecular weight of 332.40 g/mol, XLogP of 3.32, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-[4-(1,2-dihydroxyethyl)phenyl]ethenyl]naphthalene-2-carboximidamide is sourced from PubChem (CID 21186404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).