C15H20N2O5 — CID 21186665
ethyl 2-methyl-9-(nitrooxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxylate (PubChem CID 21186665) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 2-methyl-9-(nitrooxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-9-(nitrooxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21186665 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 2-methyl-9-(nitrooxymethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc1C)C(CO[N+](=O)[O-])CCCC2 |
| InChI | InChI=1S/C15H20N2O5/c1-3-21-15(18)13-8-11-6-4-5-7-12(9-22-17(19)20)14(11)16-10(13)2/h8,12H,3-7,9H2,1-2H3 |
| InChIKey | GDTFAIVZCKKLCF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|