C14H20N4O — CID 21186755
N-(diaminomethylidene)-2,8,8-trimethyl-6,7-dihydro-5H-quinoline-3-carboxamide (PubChem CID 21186755) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,8,8-trimethyl-6,7-dihydro-5H-quinoline-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,8,8-trimethyl-6,7-dihydro-5H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 21186755 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(diaminomethylidene)-2,8,8-trimethyl-6,7-dihydro-5H-quinoline-3-carboxamide |
| SMILES | Cc1nc2c(cc1C(=O)N=C(N)N)CCCC2(C)C |
| InChI | InChI=1S/C14H20N4O/c1-8-10(12(19)18-13(15)16)7-9-5-4-6-14(2,3)11(9)17-8/h7H,4-6H2,1-3H3,(H4,15,16,18,19) |
| InChIKey | QHNMTABQUCOLLH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|