About 10H-pyridazino[1,2-a]diazepine-4-carboxamide
10H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 21186962) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 10H-pyridazino[1,2-a]diazepine-4-carboxamide.
Molecular Properties
| Compound Name | 10H-pyridazino[1,2-a]diazepine-4-carboxamide |
| PubChem CID | 21186962 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 10H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | NC(=O)C1=CC=CN2CC=CC=CN12 |
| InChI | InChI=1S/C10H11N3O/c11-10(14)9-5-4-7-12-6-2-1-3-8-13(9)12/h1-5,7-8H,6H2,(H2,11,14) |
| InChIKey | SZSKFXSHURMJEZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10H-pyridazino[1,2-a]diazepine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-pyridazino[1,2-a]diazepine-4-carboxamide?
The IUPAC name of 10H-pyridazino[1,2-a]diazepine-4-carboxamide (CID 21186962) is 10H-pyridazino[1,2-a]diazepine-4-carboxamide.
What is the SMILES notation for 10H-pyridazino[1,2-a]diazepine-4-carboxamide?
The canonical SMILES for 10H-pyridazino[1,2-a]diazepine-4-carboxamide is NC(=O)C1=CC=CN2CC=CC=CN12.
What is the InChIKey of 10H-pyridazino[1,2-a]diazepine-4-carboxamide?
The InChIKey is SZSKFXSHURMJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c11-10(14)9-5-4-7-12-6-2-1-3-8-13(9)12/h1-5,7-8H,6H2,(H2,11,14).
What are the key properties of 10H-pyridazino[1,2-a]diazepine-4-carboxamide?
10H-pyridazino[1,2-a]diazepine-4-carboxamide has a molecular weight of 189.22 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-pyridazino[1,2-a]diazepine-4-carboxamide is sourced from PubChem (CID 21186962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).