C21H29N5O6 — CID 21186988
acetic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;hydrate (PubChem CID 21186988) has the molecular formula C21H29N5O6 and a molecular weight of 447.49 g/mol. Its IUPAC name is acetic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;hydrate.
| Compound Name | acetic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;hydrate |
|---|---|
| PubChem CID | 21186988 |
| Molecular Formula | C21H29N5O6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | acetic acid;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;hydrate |
| SMILES | CC(=O)O.COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC.O |
| InChI | InChI=1S/C19H23N5O3.C2H4O2.H2O/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3;1-2(3)4;/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24);1H3,(H,3,4);1H2 |
| InChIKey | NVDQULLLJIPDRP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|