C8H17NO5 — CID 21187325
N-(3,4,5,6-tetrahydroxyhexan-2-yl)acetamide (PubChem CID 21187325) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(3,4,5,6-tetrahydroxyhexan-2-yl)acetamide.
| Compound Name | N-(3,4,5,6-tetrahydroxyhexan-2-yl)acetamide |
|---|---|
| PubChem CID | 21187325 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-(3,4,5,6-tetrahydroxyhexan-2-yl)acetamide |
| SMILES | CC(=O)NC(C)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H17NO5/c1-4(9-5(2)11)7(13)8(14)6(12)3-10/h4,6-8,10,12-14H,3H2,1-2H3,(H,9,11) |
| InChIKey | GNDXKDUZRVMTHI-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |