About (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate
(4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate (PubChem CID 21187550) has the molecular formula C23H27N3O3
and a molecular weight of 393.49 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate |
| PubChem CID | 21187550 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate |
| SMILES | CCOc1ccc(COC(=O)c2cc3c(N4CCN(C)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-3-28-18-9-7-17(8-10-18)16-29-23(27)21-15-19-20(24-21)5-4-6-22(19)26-13-11-25(2)12-14-26/h4-10,15,24H,3,11-14,16H2,1-2H3 |
| InChIKey | OCYYFUFBKCBMPX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate?
The IUPAC name of (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate (CID 21187550) is (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate.
What is the SMILES notation for (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate?
The canonical SMILES for (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate is CCOc1ccc(COC(=O)c2cc3c(N4CCN(C)CC4)cccc3[nH]2)cc1.
What is the InChIKey of (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate?
The InChIKey is OCYYFUFBKCBMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O3/c1-3-28-18-9-7-17(8-10-18)16-29-23(27)21-15-19-20(24-21)5-4-6-22(19)26-13-11-25(2)12-14-26/h4-10,15,24H,3,11-14,16H2,1-2H3.
What are the key properties of (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate?
(4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate has a molecular weight of 393.49 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyphenyl)methyl 4-(4-methylpiperazin-1-yl)-1H-indole-2-carboxylate is sourced from PubChem (CID 21187550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).