C21H26O6 — CID 21188192
(3,4a,5-trimethyl-2-oxo-6-propanoyloxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl) propanoate (PubChem CID 21188192) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (3,4a,5-trimethyl-2-oxo-6-propanoyloxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl) propanoate.
| Compound Name | (3,4a,5-trimethyl-2-oxo-6-propanoyloxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl) propanoate |
|---|---|
| PubChem CID | 21188192 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (3,4a,5-trimethyl-2-oxo-6-propanoyloxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl) propanoate |
| SMILES | CCC(=O)OC1C=C2C=C3OC(=O)C(C)=C3CC2(C)C(C)C1OC(=O)CC |
| InChI | InChI=1S/C21H26O6/c1-6-17(22)25-16-9-13-8-15-14(11(3)20(24)26-15)10-21(13,5)12(4)19(16)27-18(23)7-2/h8-9,12,16,19H,6-7,10H2,1-5H3 |
| InChIKey | RBIMAPHJQCIXOT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|