C19H15ClF3N3O2 — CID 2118839
1-benzyl-5-chloro-3-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 2118839) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is 1-benzyl-5-chloro-3-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-5-chloro-3-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2118839 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 1-benzyl-5-chloro-3-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15ClF3N3O2/c1-12-16(17(20)26(25-12)11-13-5-3-2-4-6-13)18(27)24-14-7-9-15(10-8-14)28-19(21,22)23/h2-10H,11H2,1H3,(H,24,27) |
| InChIKey | UYWCJFNQYGMVRT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |